| Name | 2-Phenyl-1-propanol |
| Synonyms | 2-phenylpropan- TIMTEC-BB SBB007853 2-Phenyl-1-propanol 2-phenylpropan-1-ol RARECHEM AL BD 0123 1-Propanol, 2-phenyl- (2R)-2-phenylpropan-1-ol (2S)-2-phenylpropan-1-ol 1-Hydroxy-2-phenylpropane beta-Methylphenethyl alcohol .beta.-methyl-Benzeneethanol alpha-methylphenylethylalcohol alpha-Methyl phenylethyl alcohol 5,6,7,8-tetrahydronaphthalen-2-ol Hydratropyl alcohol~beta-Methylphenethyl alcohol |
| CAS | 1123-85-9 |
| EINECS | 214-379-7 |
| InChI | InChI=1/C9H12O/c1-8(7-10)9-5-3-2-4-6-9/h2-6,8,10H,7H2,1H3/t8-/m1/s1 |
| InChIKey | RNDNSYIPLPAXAZ-UHFFFAOYSA-N |
| Molecular Formula | C9H12O |
| Molar Mass | 136.19 |
| Density | 0.975 g/mL at 25 °C (lit.) |
| Melting Point | -37 °C |
| Boling Point | 110-111 °C/10 mmHg (lit.) |
| Flash Point | 201°F |
| JECFA Number | 1459 |
| Water Solubility | insoluble |
| Vapor Presure | 3.45hPa at 25℃ |
| Appearance | clear liquid |
| Specific Gravity | 1.015 |
| Color | Colorless to Almost colorless |
| BRN | 1906760 |
| pKa | 14.79±0.10(Predicted) |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | n20/D 1.526(lit.) |
| MDL | MFCD00004736 |
| Hazard Symbols | Xn - Harmful![]() |
| Risk Codes | 22 - Harmful if swallowed |
| Safety Description | S23 - Do not breathe vapour. S24/25 - Avoid contact with skin and eyes. S36 - Wear suitable protective clothing. |
| WGK Germany | 2 |
| RTECS | SG8590000 |
| TSCA | Yes |
| HS Code | 29062900 |
| FEMA | 2732 | BETA-METHYLPHENETHYL ALCOHOL |
| LogP | 1.8 at 20℃ |
| NIST chemical information | Information provided by: webbook.nist.gov (external link) |
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |